C23H26N4O4 — CID 129191956
1-cyclopropyl-3-[(1S,2S,3S)-2-[(3E,5E)-3-hydroxy-6-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]hepta-1,3,5-trien-2-yl]-1-bicyclo[1.1.0]butanyl]urea (PubChem CID 129191956) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1S,2S,3S)-2-[(3E,5E)-3-hydroxy-6-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]hepta-1,3,5-trien-2-yl]-1-bicyclo[1.1.0]butanyl]urea.
| Compound Name | 1-cyclopropyl-3-[(1S,2S,3S)-2-[(3E,5E)-3-hydroxy-6-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]hepta-1,3,5-trien-2-yl]-1-bicyclo[1.1.0]butanyl]urea |
|---|---|
| PubChem CID | 129191956 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-cyclopropyl-3-[(1S,2S,3S)-2-[(3E,5E)-3-hydroxy-6-[(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)oxy]hepta-1,3,5-trien-2-yl]-1-bicyclo[1.1.0]butanyl]urea |
| SMILES | C=C(/C(O)=C\C=C(/C)Oc1ccnc2c1CCC(=O)N2)[C@@H]1[C@@H]2C[C@@]12NC(=O)NC1CC1 |
| InChI | InChI=1S/C23H26N4O4/c1-12(31-18-9-10-24-21-15(18)6-8-19(29)26-21)3-7-17(28)13(2)20-16-11-23(16,20)27-22(30)25-14-4-5-14/h3,7,9-10,14,16,20,28H,2,4-6,8,11H2,1H3,(H,24,26,29)(H2,25,27,30)/b12-3+,17-7+/t16-,20+,23-/m0/s1 |
| InChIKey | YVCQXOIBYHFXMK-URRSHLLESA-N |
| XLogP | 3.10 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|