C26H33ClN2O3 — CID 12919563
4-[2-[[2-[butyl(cyclohexyl)amino]-5-chlorobenzoyl]amino]ethyl]benzoic acid (PubChem CID 12919563) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is 4-[2-[[2-[butyl(cyclohexyl)amino]-5-chlorobenzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[2-[butyl(cyclohexyl)amino]-5-chlorobenzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 12919563 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-[2-[[2-[butyl(cyclohexyl)amino]-5-chlorobenzoyl]amino]ethyl]benzoic acid |
| SMILES | CCCCN(c1ccc(Cl)cc1C(=O)NCCc1ccc(C(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-2-3-17-29(22-7-5-4-6-8-22)24-14-13-21(27)18-23(24)25(30)28-16-15-19-9-11-20(12-10-19)26(31)32/h9-14,18,22H,2-8,15-17H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | LLMLTNFGURKUHZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |