C14H27N — CID 129197644
2,5,5-trimethyl-3-methylidene-N-prop-1-en-2-ylheptan-4-amine (PubChem CID 129197644) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 2,5,5-trimethyl-3-methylidene-N-prop-1-en-2-ylheptan-4-amine.
| Compound Name | 2,5,5-trimethyl-3-methylidene-N-prop-1-en-2-ylheptan-4-amine |
|---|---|
| PubChem CID | 129197644 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 2,5,5-trimethyl-3-methylidene-N-prop-1-en-2-ylheptan-4-amine |
| SMILES | C=C(C)NC(C(=C)C(C)C)C(C)(C)CC |
| InChI | InChI=1S/C14H27N/c1-9-14(7,8)13(15-11(4)5)12(6)10(2)3/h10,13,15H,4,6,9H2,1-3,5,7-8H3 |
| InChIKey | CLOQQFCPKJDRDC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|