C11H18O3 — CID 129199121
(4R)-4-(1-methoxyethenyl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane (PubChem CID 129199121) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (4R)-4-(1-methoxyethenyl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane.
| Compound Name | (4R)-4-(1-methoxyethenyl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 129199121 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (4R)-4-(1-methoxyethenyl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane |
| SMILES | C=C(C)C1OC(C)(C)O[C@H]1C(=C)OC |
| InChI | InChI=1S/C11H18O3/c1-7(2)9-10(8(3)12-6)14-11(4,5)13-9/h9-10H,1,3H2,2,4-6H3/t9?,10-/m0/s1 |
| InChIKey | AMCFNXDUWQYDMZ-AXDSSHIGSA-N |
| XLogP | 2.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|