C12H22O3 — CID 135057215
(4R,5S)-4-(2-methoxypropan-2-yl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane (PubChem CID 135057215) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (4R,5S)-4-(2-methoxypropan-2-yl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-(2-methoxypropan-2-yl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane |
|---|---|
| PubChem CID | 135057215 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (4R,5S)-4-(2-methoxypropan-2-yl)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolane |
| SMILES | C=C(C)[C@@H]1OC(C)(C)O[C@H]1C(C)(C)OC |
| InChI | InChI=1S/C12H22O3/c1-8(2)9-10(11(3,4)13-7)15-12(5,6)14-9/h9-10H,1H2,2-7H3/t9-,10+/m0/s1 |
| InChIKey | XTXHJNLCKXBZOP-VHSXEESVSA-N |
| XLogP | 2.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|