C15H26O4 — CID 11173275
2-[(2S,3R,5R)-5-[(4S,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-methyloxolan-2-yl]ethanol (PubChem CID 11173275) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[(2S,3R,5R)-5-[(4S,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-methyloxolan-2-yl]ethanol.
| Compound Name | 2-[(2S,3R,5R)-5-[(4S,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-methyloxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 11173275 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-[(2S,3R,5R)-5-[(4S,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-methyloxolan-2-yl]ethanol |
| SMILES | C=C(C)[C@H]1OC(C)(C)O[C@H]1[C@H]1C[C@@H](C)[C@H](CCO)O1 |
| InChI | InChI=1S/C15H26O4/c1-9(2)13-14(19-15(4,5)18-13)12-8-10(3)11(17-12)6-7-16/h10-14,16H,1,6-8H2,2-5H3/t10-,11+,12-,13-,14+/m1/s1 |
| InChIKey | IEAZSXFLPNCVDI-ITGHMWBKSA-N |
| XLogP | 2.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|