C14H24O4 — CID 11107962
3-[(3aR,4R,6R,7aS)-2,2-dimethyl-4-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]propan-1-ol (PubChem CID 11107962) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 3-[(3aR,4R,6R,7aS)-2,2-dimethyl-4-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]propan-1-ol.
| Compound Name | 3-[(3aR,4R,6R,7aS)-2,2-dimethyl-4-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]propan-1-ol |
|---|---|
| PubChem CID | 11107962 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-[(3aR,4R,6R,7aS)-2,2-dimethyl-4-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]propan-1-ol |
| SMILES | C=CC[C@H]1O[C@H](CCCO)C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H24O4/c1-4-6-11-13-12(17-14(2,3)18-13)9-10(16-11)7-5-8-15/h4,10-13,15H,1,5-9H2,2-3H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | AIUVDBCMOUVTIA-FVCCEPFGSA-N |
| XLogP | 2.01 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|