C7H14N2O4S — CID 129202774
N-[1-[ethoxy(methylsulfonyl)amino]ethenyl]acetamide (PubChem CID 129202774) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is N-[1-[ethoxy(methylsulfonyl)amino]ethenyl]acetamide.
| Compound Name | N-[1-[ethoxy(methylsulfonyl)amino]ethenyl]acetamide |
|---|---|
| PubChem CID | 129202774 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | N-[1-[ethoxy(methylsulfonyl)amino]ethenyl]acetamide |
| SMILES | C=C(NC(C)=O)N(OCC)S(C)(=O)=O |
| InChI | InChI=1S/C7H14N2O4S/c1-5-13-9(14(4,11)12)6(2)8-7(3)10/h2,5H2,1,3-4H3,(H,8,10) |
| InChIKey | MHIAWGVXMMFIJM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|