About N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide
N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide (PubChem CID 154447819) has the molecular formula C4H13N3O5S2
and a molecular weight of 247.30 g/mol. Its IUPAC name is N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide.
Molecular Properties
| Compound Name | N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide |
| PubChem CID | 154447819 |
| Molecular Formula | C4H13N3O5S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide |
| SMILES | CCON(NS(C)(=O)=O)NS(C)(=O)=O |
| InChI | InChI=1S/C4H13N3O5S2/c1-4-12-7(5-13(2,8)9)6-14(3,10)11/h5-6H,4H2,1-3H3 |
| InChIKey | KOFNSYSZPXRXOS-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide?
The IUPAC name of N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide (CID 154447819) is N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide.
What is the SMILES notation for N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide?
The canonical SMILES for N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide is CCON(NS(C)(=O)=O)NS(C)(=O)=O.
What is the InChIKey of N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide?
The InChIKey is KOFNSYSZPXRXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13N3O5S2/c1-4-12-7(5-13(2,8)9)6-14(3,10)11/h5-6H,4H2,1-3H3.
What are the key properties of N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide?
N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide has a molecular weight of 247.30 g/mol, XLogP of -1.83, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethoxy-N'-(methanesulfonamido)methanesulfonohydrazide is sourced from PubChem (CID 154447819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).