C10H24N2O4 — CID 86169848
N,N,N',N'-tetraethoxyethane-1,2-diamine (PubChem CID 86169848) has the molecular formula C10H24N2O4 and a molecular weight of 236.31 g/mol. Its IUPAC name is N,N,N',N'-tetraethoxyethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetraethoxyethane-1,2-diamine |
|---|---|
| PubChem CID | 86169848 |
| Molecular Formula | C10H24N2O4 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N,N,N',N'-tetraethoxyethane-1,2-diamine |
| SMILES | CCON(CCN(OCC)OCC)OCC |
| InChI | InChI=1S/C10H24N2O4/c1-5-13-11(14-6-2)9-10-12(15-7-3)16-8-4/h5-10H2,1-4H3 |
| InChIKey | WTWONWFFUJVILO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|