C10H14O4 — CID 129205536
(2S)-5-acetyl-4-hydroxy-2-propyl-2,3-dihydropyran-6-one (PubChem CID 129205536) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2S)-5-acetyl-4-hydroxy-2-propyl-2,3-dihydropyran-6-one.
| Compound Name | (2S)-5-acetyl-4-hydroxy-2-propyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 129205536 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2S)-5-acetyl-4-hydroxy-2-propyl-2,3-dihydropyran-6-one |
| SMILES | CCC[C@H]1CC(O)=C(C(C)=O)C(=O)O1 |
| InChI | InChI=1S/C10H14O4/c1-3-4-7-5-8(12)9(6(2)11)10(13)14-7/h7,12H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | DNFXUCPNLZRODD-ZETCQYMHSA-N |
| XLogP | 1.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|