C21H17N5O — CID 129206893
4-[3-[2-(cyclopropylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzaldehyde (PubChem CID 129206893) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is 4-[3-[2-(cyclopropylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzaldehyde.
| Compound Name | 4-[3-[2-(cyclopropylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 129206893 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[3-[2-(cyclopropylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2cnc3[nH]cc(-c4ccnc(NC5CC5)n4)c3c2)cc1 |
| InChI | InChI=1S/C21H17N5O/c27-12-13-1-3-14(4-2-13)15-9-17-18(11-24-20(17)23-10-15)19-7-8-22-21(26-19)25-16-5-6-16/h1-4,7-12,16H,5-6H2,(H,23,24)(H,22,25,26) |
| InChIKey | KGLHLVMGEJYIGA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|