C22H29N3O4 — CID 129207042
N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2-(dimethylamino)benzamide (PubChem CID 129207042) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2-(dimethylamino)benzamide.
| Compound Name | N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 129207042 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2-(dimethylamino)benzamide |
| SMILES | CCO[C@H](CNC(=O)c1ccccc1N(C)C)[C@@H](O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O4/c1-4-29-20(19(26)14-23-21(27)16-10-6-5-7-11-16)15-24-22(28)17-12-8-9-13-18(17)25(2)3/h5-13,19-20,26H,4,14-15H2,1-3H3,(H,23,27)(H,24,28)/t19-,20+/m0/s1 |
| InChIKey | PIBAIFAWNVYAIS-VQTJNVASSA-N |
| XLogP | 1.68 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |