C18H22N4O4 — CID 129207253
N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]pyrimidine-5-carboxamide (PubChem CID 129207253) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]pyrimidine-5-carboxamide.
| Compound Name | N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 129207253 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]pyrimidine-5-carboxamide |
| SMILES | CCO[C@H](CNC(=O)c1cncnc1)[C@@H](O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22N4O4/c1-2-26-16(11-22-18(25)14-8-19-12-20-9-14)15(23)10-21-17(24)13-6-4-3-5-7-13/h3-9,12,15-16,23H,2,10-11H2,1H3,(H,21,24)(H,22,25)/t15-,16+/m0/s1 |
| InChIKey | UXXQPZKZIXXMCH-JKSUJKDBSA-N |
| XLogP | 0.40 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |