About 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one
1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one (PubChem CID 129211836) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one |
| PubChem CID | 129211836 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCNC(c2[nH]cc(C)c2C)C1 |
| InChI | InChI=1S/C13H21N3O/c1-4-12(17)16-6-5-14-11(8-16)13-10(3)9(2)7-15-13/h7,11,14-15H,4-6,8H2,1-3H3 |
| InChIKey | KCBGSMKLIGPIMX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one?
The IUPAC name of 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one (CID 129211836) is 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one.
What is the SMILES notation for 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one?
The canonical SMILES for 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one is CCC(=O)N1CCNC(c2[nH]cc(C)c2C)C1.
What is the InChIKey of 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one?
The InChIKey is KCBGSMKLIGPIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-4-12(17)16-6-5-14-11(8-16)13-10(3)9(2)7-15-13/h7,11,14-15H,4-6,8H2,1-3H3.
What are the key properties of 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one?
1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one has a molecular weight of 235.33 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,4-dimethyl-1H-pyrrol-2-yl)piperazin-1-yl]propan-1-one is sourced from PubChem (CID 129211836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).