C10H10N2O — CID 12921189
5-methoxy-1H-2,4-benzodiazepine (PubChem CID 12921189) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-methoxy-1H-2,4-benzodiazepine.
| Compound Name | 5-methoxy-1H-2,4-benzodiazepine |
|---|---|
| PubChem CID | 12921189 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5-methoxy-1H-2,4-benzodiazepine |
| SMILES | COC1=NC=NCc2ccccc21 |
| InChI | InChI=1S/C10H10N2O/c1-13-10-9-5-3-2-4-8(9)6-11-7-12-10/h2-5,7H,6H2,1H3 |
| InChIKey | CULPFFBHFILDLM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |