About 9-butyl-2,7-dimethylcarbazole
9-butyl-2,7-dimethylcarbazole (PubChem CID 129212268) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is 9-butyl-2,7-dimethylcarbazole.
Molecular Properties
| Compound Name | 9-butyl-2,7-dimethylcarbazole |
| PubChem CID | 129212268 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 9-butyl-2,7-dimethylcarbazole |
| SMILES | CCCCn1c2cc(C)ccc2c2ccc(C)cc21 |
| InChI | InChI=1S/C18H21N/c1-4-5-10-19-17-11-13(2)6-8-15(17)16-9-7-14(3)12-18(16)19/h6-9,11-12H,4-5,10H2,1-3H3 |
| InChIKey | ZTDZRZVYVLTDOI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-butyl-2,7-dimethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-2,7-dimethylcarbazole?
The IUPAC name of 9-butyl-2,7-dimethylcarbazole (CID 129212268) is 9-butyl-2,7-dimethylcarbazole.
What is the SMILES notation for 9-butyl-2,7-dimethylcarbazole?
The canonical SMILES for 9-butyl-2,7-dimethylcarbazole is CCCCn1c2cc(C)ccc2c2ccc(C)cc21.
What is the InChIKey of 9-butyl-2,7-dimethylcarbazole?
The InChIKey is ZTDZRZVYVLTDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N/c1-4-5-10-19-17-11-13(2)6-8-15(17)16-9-7-14(3)12-18(16)19/h6-9,11-12H,4-5,10H2,1-3H3.
What are the key properties of 9-butyl-2,7-dimethylcarbazole?
9-butyl-2,7-dimethylcarbazole has a molecular weight of 251.37 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-2,7-dimethylcarbazole is sourced from PubChem (CID 129212268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).