C8H9F9N2O2S — CID 129218133
1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazine (PubChem CID 129218133) has the molecular formula C8H9F9N2O2S and a molecular weight of 368.22 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazine.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazine |
|---|---|
| PubChem CID | 129218133 |
| Molecular Formula | C8H9F9N2O2S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazine |
| SMILES | O=S(=O)(N1CCNCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9N2O2S/c9-5(10,7(13,14)15)6(11,12)8(16,17)22(20,21)19-3-1-18-2-4-19/h18H,1-4H2 |
| InChIKey | YQKDBWLHJXWCOX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|