C20H17ClF3N3O2S — CID 129219225
2-[5-[4-chloro-3-(trifluoromethyl)phenyl]-4-oxothieno[2,3-d]pyrimidin-3-yl]-3-pyrrolidin-1-ylpropanal (PubChem CID 129219225) has the molecular formula C20H17ClF3N3O2S and a molecular weight of 455.89 g/mol. Its IUPAC name is 2-[5-[4-chloro-3-(trifluoromethyl)phenyl]-4-oxothieno[2,3-d]pyrimidin-3-yl]-3-pyrrolidin-1-ylpropanal.
| Compound Name | 2-[5-[4-chloro-3-(trifluoromethyl)phenyl]-4-oxothieno[2,3-d]pyrimidin-3-yl]-3-pyrrolidin-1-ylpropanal |
|---|---|
| PubChem CID | 129219225 |
| Molecular Formula | C20H17ClF3N3O2S |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2-[5-[4-chloro-3-(trifluoromethyl)phenyl]-4-oxothieno[2,3-d]pyrimidin-3-yl]-3-pyrrolidin-1-ylpropanal |
| SMILES | O=CC(CN1CCCC1)n1cnc2scc(-c3ccc(Cl)c(C(F)(F)F)c3)c2c1=O |
| InChI | InChI=1S/C20H17ClF3N3O2S/c21-16-4-3-12(7-15(16)20(22,23)24)14-10-30-18-17(14)19(29)27(11-25-18)13(9-28)8-26-5-1-2-6-26/h3-4,7,9-11,13H,1-2,5-6,8H2 |
| InChIKey | NVUIUAZGSINSNQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|