C18H21ClN6S — CID 129221266
(2-chloro-4-imidazol-1-ylbenzenecarboximidoyl) 2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboximidothioate (PubChem CID 129221266) has the molecular formula C18H21ClN6S and a molecular weight of 388.93 g/mol. Its IUPAC name is (2-chloro-4-imidazol-1-ylbenzenecarboximidoyl) 2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboximidothioate.
| Compound Name | (2-chloro-4-imidazol-1-ylbenzenecarboximidoyl) 2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboximidothioate |
|---|---|
| PubChem CID | 129221266 |
| Molecular Formula | C18H21ClN6S |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (2-chloro-4-imidazol-1-ylbenzenecarboximidoyl) 2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(-n2ccnc2)cc1Cl)N1CC2CN(C)CC2C1 |
| InChI | InChI=1S/C18H21ClN6S/c1-23-7-12-9-25(10-13(12)8-23)18(21)26-17(20)15-3-2-14(6-16(15)19)24-5-4-22-11-24/h2-6,11-13,20-21H,7-10H2,1H3/b20-17+,21-18- |
| InChIKey | XLFXOJHZKBSRBZ-QFKMPRMPSA-N |
| XLogP | 3.01 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|