C18H16ClN5S — CID 168611308
benzyl N'-[(2-chloro-4-imidazol-1-ylphenyl)methylideneamino]carbamimidothioate (PubChem CID 168611308) has the molecular formula C18H16ClN5S and a molecular weight of 369.88 g/mol. Its IUPAC name is benzyl N'-[(2-chloro-4-imidazol-1-ylphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(2-chloro-4-imidazol-1-ylphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611308 |
| Molecular Formula | C18H16ClN5S |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | benzyl N'-[(2-chloro-4-imidazol-1-ylphenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(-n2ccnc2)cc1Cl)SCc1ccccc1 |
| InChI | InChI=1S/C18H16ClN5S/c19-17-10-16(24-9-8-21-13-24)7-6-15(17)11-22-23-18(20)25-12-14-4-2-1-3-5-14/h1-11,13H,12H2,(H2,20,23) |
| InChIKey | VTCNOOQJIDCHGH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 68.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|