C14H9ClFN5O3S — CID 129229053
7-chloro-6-fluoro-3-(1H-indazol-5-ylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol (PubChem CID 129229053) has the molecular formula C14H9ClFN5O3S and a molecular weight of 381.78 g/mol. Its IUPAC name is 7-chloro-6-fluoro-3-(1H-indazol-5-ylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol.
| Compound Name | 7-chloro-6-fluoro-3-(1H-indazol-5-ylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol |
|---|---|
| PubChem CID | 129229053 |
| Molecular Formula | C14H9ClFN5O3S |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 7-chloro-6-fluoro-3-(1H-indazol-5-ylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-ol |
| SMILES | O=S1(=O)N=C(Nc2ccc3[nH]ncc3c2)Nc2c1cc(Cl)c(F)c2O |
| InChI | InChI=1S/C14H9ClFN5O3S/c15-8-4-10-12(13(22)11(8)16)19-14(21-25(10,23)24)18-7-1-2-9-6(3-7)5-17-20-9/h1-5,22H,(H,17,20)(H2,18,19,21) |
| InChIKey | BQZFOIFWWMQTDR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|