C24H26N6O4S — CID 129233714
7-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]-6-oxo-N-[2-(prop-2-enoylamino)ethyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129233714) has the molecular formula C24H26N6O4S and a molecular weight of 494.58 g/mol. Its IUPAC name is 7-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]-6-oxo-N-[2-(prop-2-enoylamino)ethyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]-6-oxo-N-[2-(prop-2-enoylamino)ethyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129233714 |
| Molecular Formula | C24H26N6O4S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 7-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]-6-oxo-N-[2-(prop-2-enoylamino)ethyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)NCCNC(=O)c1sc2nccc3c2c1NC(=O)N3c1cnc(OCC(C)C)cc1C |
| InChI | InChI=1S/C24H26N6O4S/c1-5-17(31)25-8-9-26-22(32)21-20-19-15(6-7-27-23(19)35-21)30(24(33)29-20)16-11-28-18(10-14(16)4)34-12-13(2)3/h5-7,10-11,13H,1,8-9,12H2,2-4H3,(H,25,31)(H,26,32)(H,29,33) |
| InChIKey | USZQVQDVWYVLGO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|