C13H23NO — CID 129233891
(E)-4,5-dimethyl-1-piperidin-1-ylhex-1-en-3-one (PubChem CID 129233891) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (E)-4,5-dimethyl-1-piperidin-1-ylhex-1-en-3-one.
| Compound Name | (E)-4,5-dimethyl-1-piperidin-1-ylhex-1-en-3-one |
|---|---|
| PubChem CID | 129233891 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (E)-4,5-dimethyl-1-piperidin-1-ylhex-1-en-3-one |
| SMILES | CC(C)C(C)C(=O)/C=C/N1CCCCC1 |
| InChI | InChI=1S/C13H23NO/c1-11(2)12(3)13(15)7-10-14-8-5-4-6-9-14/h7,10-12H,4-6,8-9H2,1-3H3/b10-7+ |
| InChIKey | FHXCMXAIJZYDLI-JXMROGBWSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|