C15H21NO2 — CID 129234900
[[(1R)-2-methylcyclohexyl]amino]methyl benzoate (PubChem CID 129234900) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is [[(1R)-2-methylcyclohexyl]amino]methyl benzoate.
| Compound Name | [[(1R)-2-methylcyclohexyl]amino]methyl benzoate |
|---|---|
| PubChem CID | 129234900 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | [[(1R)-2-methylcyclohexyl]amino]methyl benzoate |
| SMILES | CC1CCCC[C@H]1NCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-12-7-5-6-10-14(12)16-11-18-15(17)13-8-3-2-4-9-13/h2-4,8-9,12,14,16H,5-7,10-11H2,1H3/t12?,14-/m1/s1 |
| InChIKey | PAXMUYSGJKELCW-TYZXPVIJSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|