C10H20ClN — CID 12923590
1-(3-chloropropyl)-2,6-dimethylpiperidine (PubChem CID 12923590) has the molecular formula C10H20ClN and a molecular weight of 189.73 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,6-dimethylpiperidine.
| Compound Name | 1-(3-chloropropyl)-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 12923590 |
| Molecular Formula | C10H20ClN |
| Molecular Weight | 189.73 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(3-chloropropyl)-2,6-dimethylpiperidine |
| SMILES | CC1CCCC(C)N1CCCCl |
| InChI | InChI=1S/C10H20ClN/c1-9-5-3-6-10(2)12(9)8-4-7-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | VOGQZKPKCZDFBF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|