C16H27FO6 — CID 129236024
[(3S,4S,5S)-4-(5-fluoropentanoyloxy)-5-(hydroxymethyl)oxolan-3-yl] hexanoate (PubChem CID 129236024) has the molecular formula C16H27FO6 and a molecular weight of 334.38 g/mol. Its IUPAC name is [(3S,4S,5S)-4-(5-fluoropentanoyloxy)-5-(hydroxymethyl)oxolan-3-yl] hexanoate.
| Compound Name | [(3S,4S,5S)-4-(5-fluoropentanoyloxy)-5-(hydroxymethyl)oxolan-3-yl] hexanoate |
|---|---|
| PubChem CID | 129236024 |
| Molecular Formula | C16H27FO6 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(3S,4S,5S)-4-(5-fluoropentanoyloxy)-5-(hydroxymethyl)oxolan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1CO[C@@H](CO)[C@@H]1OC(=O)CCCCF |
| InChI | InChI=1S/C16H27FO6/c1-2-3-4-7-14(19)22-13-11-21-12(10-18)16(13)23-15(20)8-5-6-9-17/h12-13,16,18H,2-11H2,1H3/t12-,13-,16-/m0/s1 |
| InChIKey | BHYDDRJDOUXVCC-XEZPLFJOSA-N |
| XLogP | 1.92 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|