C48H87NO7 — CID 166042513
[(4S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[8-(2-octylcyclopropyl)octanoyloxy]oxolan-3-yl] 8-(2-octylcyclopropyl)octanoate (PubChem CID 166042513) has the molecular formula C48H87NO7 and a molecular weight of 790.22 g/mol. Its IUPAC name is [(4S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[8-(2-octylcyclopropyl)octanoyloxy]oxolan-3-yl] 8-(2-octylcyclopropyl)octanoate.
| Compound Name | [(4S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[8-(2-octylcyclopropyl)octanoyloxy]oxolan-3-yl] 8-(2-octylcyclopropyl)octanoate |
|---|---|
| PubChem CID | 166042513 |
| Molecular Formula | C48H87NO7 |
| Molecular Weight | 790.22 g/mol |
| Exact Mass | 789.65 |
| IUPAC Name | [(4S,5R)-5-[3-(dimethylamino)propanoyloxymethyl]-4-[8-(2-octylcyclopropyl)octanoyloxy]oxolan-3-yl] 8-(2-octylcyclopropyl)octanoate |
| SMILES | CCCCCCCCC1CC1CCCCCCCC(=O)OC1CO[C@H](COC(=O)CCN(C)C)[C@@H]1OC(=O)CCCCCCCC1CC1CCCCCCCC |
| InChI | InChI=1S/C48H87NO7/c1-5-7-9-11-15-21-27-39-35-41(39)29-23-17-13-19-25-31-46(51)55-44-38-53-43(37-54-45(50)33-34-49(3)4)48(44)56-47(52)32-26-20-14-18-24-30-42-36-40(42)28-22-16-12-10-8-6-2/h39-44,48H,5-38H2,1-4H3/t39?,40?,41?,42?,43-,44?,48+/m1/s1 |
| InChIKey | LILPEJRPZRQEJI-OWTDWQSTSA-N |
| XLogP | 11.94 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.22 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|