C52H91NO7 — CID 166042568
[(2R,3S,4S)-3,4-bis[8-(2-octylcyclopropyl)octanoyloxy]oxolan-2-yl]methyl 1-cyclopropylpiperidine-4-carboxylate (PubChem CID 166042568) has the molecular formula C52H91NO7 and a molecular weight of 842.30 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-bis[8-(2-octylcyclopropyl)octanoyloxy]oxolan-2-yl]methyl 1-cyclopropylpiperidine-4-carboxylate.
| Compound Name | [(2R,3S,4S)-3,4-bis[8-(2-octylcyclopropyl)octanoyloxy]oxolan-2-yl]methyl 1-cyclopropylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166042568 |
| Molecular Formula | C52H91NO7 |
| Molecular Weight | 842.30 g/mol |
| Exact Mass | 841.68 |
| IUPAC Name | [(2R,3S,4S)-3,4-bis[8-(2-octylcyclopropyl)octanoyloxy]oxolan-2-yl]methyl 1-cyclopropylpiperidine-4-carboxylate |
| SMILES | CCCCCCCCC1CC1CCCCCCCC(=O)O[C@@H]1[C@@H](OC(=O)CCCCCCCC2CC2CCCCCCCC)CO[C@@H]1COC(=O)C1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C52H91NO7/c1-3-5-7-9-13-19-25-42-37-44(42)27-21-15-11-17-23-29-49(54)59-48-40-57-47(39-58-52(56)41-33-35-53(36-34-41)46-31-32-46)51(48)60-50(55)30-24-18-12-16-22-28-45-38-43(45)26-20-14-10-8-6-4-2/h41-48,51H,3-40H2,1-2H3/t42?,43?,44?,45?,47-,48+,51+/m1/s1 |
| InChIKey | HNXZPRULRBBNJS-YLDKTBJZSA-N |
| XLogP | 12.86 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.30 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|