C27H53N5O12 — CID 129236495
methyl 2-[4-[2-hydroxy-3-[methyl(2,3,4,5,6-pentahydroxyhexyl)amino]propyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 129236495) has the molecular formula C27H53N5O12 and a molecular weight of 639.74 g/mol. Its IUPAC name is methyl 2-[4-[2-hydroxy-3-[methyl(2,3,4,5,6-pentahydroxyhexyl)amino]propyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | methyl 2-[4-[2-hydroxy-3-[methyl(2,3,4,5,6-pentahydroxyhexyl)amino]propyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 129236495 |
| Molecular Formula | C27H53N5O12 |
| Molecular Weight | 639.74 g/mol |
| Exact Mass | 639.37 |
| IUPAC Name | methyl 2-[4-[2-hydroxy-3-[methyl(2,3,4,5,6-pentahydroxyhexyl)amino]propyl]-7,10-bis(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(CC(=O)OC)CCN(CC(O)CN(C)CC(O)C(O)C(O)C(O)CO)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C27H53N5O12/c1-28(15-21(35)26(40)27(41)22(36)19-33)13-20(34)14-29-5-7-30(16-23(37)42-2)9-11-32(18-25(39)44-4)12-10-31(8-6-29)17-24(38)43-3/h20-22,26-27,33-36,40-41H,5-19H2,1-4H3 |
| InChIKey | OCZMKAWKVQWVJS-UHFFFAOYSA-N |
| XLogP | -5.54 |
| TPSA | 216.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.74 |
| LogP ≤ 5 | -5.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|