C27H27F3N6O4 — CID 129236839
3-[7-[[4-[[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 129236839) has the molecular formula C27H27F3N6O4 and a molecular weight of 556.55 g/mol. Its IUPAC name is 3-[7-[[4-[[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 129236839 |
| Molecular Formula | C27H27F3N6O4 |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 3-[7-[[4-[[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [H]/N=C1\CN(Cc2ccc(COc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)cc2)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C27H27F3N6O4/c28-27(29,30)26(32)35-11-10-34(14-22(35)31)12-16-4-6-17(7-5-16)15-40-21-3-1-2-18-19(21)13-36(25(18)39)20-8-9-23(37)33-24(20)38/h1-7,20,31-32H,8-15H2,(H,33,37,38)/b31-22+,32-26+ |
| InChIKey | HFPJXWNOZVVDEV-MBQRIEKJSA-N |
| XLogP | 2.66 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|