C31H32ClFN4O4 — CID 129237199
(3R,4S,7S)-4-[3-(5-chloro-1,3-dioxopyrido[1,2-c]pyrimidin-2-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,5,6,7,8,9-octahydro-1H-carbazole-1-carboxamide (PubChem CID 129237199) has the molecular formula C31H32ClFN4O4 and a molecular weight of 579.07 g/mol. Its IUPAC name is (3R,4S,7S)-4-[3-(5-chloro-1,3-dioxopyrido[1,2-c]pyrimidin-2-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,5,6,7,8,9-octahydro-1H-carbazole-1-carboxamide.
| Compound Name | (3R,4S,7S)-4-[3-(5-chloro-1,3-dioxopyrido[1,2-c]pyrimidin-2-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,5,6,7,8,9-octahydro-1H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 129237199 |
| Molecular Formula | C31H32ClFN4O4 |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | (3R,4S,7S)-4-[3-(5-chloro-1,3-dioxopyrido[1,2-c]pyrimidin-2-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,5,6,7,8,9-octahydro-1H-carbazole-1-carboxamide |
| SMILES | Cc1c([C@H]2c3c([nH]c4c3CC[C@H](C(C)(C)O)C4)C(C(N)=O)C[C@H]2F)cccc1-n1c(=O)cc2c(Cl)cccn2c1=O |
| InChI | InChI=1S/C31H32ClFN4O4/c1-15-17(6-4-8-23(15)37-25(38)14-24-20(32)7-5-11-36(24)30(37)40)26-21(33)13-19(29(34)39)28-27(26)18-10-9-16(31(2,3)41)12-22(18)35-28/h4-8,11,14,16,19,21,26,35,41H,9-10,12-13H2,1-3H3,(H2,34,39)/t16-,19?,21+,26+/m0/s1 |
| InChIKey | NLJRQGBRVLHFNH-YZZOWGFKSA-N |
| XLogP | 4.06 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |