C31H30F2N4O4 — CID 129237322
(7S)-3-fluoro-4-[3-(8-fluoro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-4,5,6,7,8,9-hexahydro-3H-carbazole-1-carboxamide (PubChem CID 129237322) has the molecular formula C31H30F2N4O4 and a molecular weight of 560.60 g/mol. Its IUPAC name is (7S)-3-fluoro-4-[3-(8-fluoro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-4,5,6,7,8,9-hexahydro-3H-carbazole-1-carboxamide.
| Compound Name | (7S)-3-fluoro-4-[3-(8-fluoro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-4,5,6,7,8,9-hexahydro-3H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 129237322 |
| Molecular Formula | C31H30F2N4O4 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | (7S)-3-fluoro-4-[3-(8-fluoro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-4,5,6,7,8,9-hexahydro-3H-carbazole-1-carboxamide |
| SMILES | Cc1c(C2c3c([nH]c4c3CC[C@H](C(C)(C)O)C4)C(C(N)=O)=CC2F)cccc1-n1c(=O)[nH]c2c(F)cccc2c1=O |
| InChI | InChI=1S/C31H30F2N4O4/c1-14-16(6-5-9-23(14)37-29(39)18-7-4-8-20(32)26(18)36-30(37)40)24-21(33)13-19(28(34)38)27-25(24)17-11-10-15(31(2,3)41)12-22(17)35-27/h4-9,13,15,21,24,35,41H,10-12H2,1-3H3,(H2,34,38)(H,36,40)/t15-,21?,24?/m0/s1 |
| InChIKey | IPCXLYHPTZYWPV-RZJRRJPXSA-N |
| XLogP | 3.68 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |