C31H28ClFN4O4 — CID 129237347
(3R,4S)-4-[3-(8-chloro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (PubChem CID 129237347) has the molecular formula C31H28ClFN4O4 and a molecular weight of 575.04 g/mol. Its IUPAC name is (3R,4S)-4-[3-(8-chloro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide.
| Compound Name | (3R,4S)-4-[3-(8-chloro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 129237347 |
| Molecular Formula | C31H28ClFN4O4 |
| Molecular Weight | 575.04 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | (3R,4S)-4-[3-(8-chloro-2,4-dioxo-1H-quinazolin-3-yl)-2-methylphenyl]-3-fluoro-7-(2-hydroxypropan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| SMILES | Cc1c([C@H]2c3c([nH]c4cc(C(C)(C)O)ccc34)C(C(N)=O)C[C@H]2F)cccc1-n1c(=O)[nH]c2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C31H28ClFN4O4/c1-14-16(6-5-9-23(14)37-29(39)18-7-4-8-20(32)26(18)36-30(37)40)24-21(33)13-19(28(34)38)27-25(24)17-11-10-15(31(2,3)41)12-22(17)35-27/h4-12,19,21,24,35,41H,13H2,1-3H3,(H2,34,38)(H,36,40)/t19?,21-,24-/m1/s1 |
| InChIKey | XRZCMXCEQYBZLD-JNKRKRSOSA-N |
| XLogP | 4.79 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.04 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |