C25H25F4N5O8S2 — CID 129239621
[3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate (PubChem CID 129239621) has the molecular formula C25H25F4N5O8S2 and a molecular weight of 663.63 g/mol. Its IUPAC name is [3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate.
| Compound Name | [3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 129239621 |
| Molecular Formula | C25H25F4N5O8S2 |
| Molecular Weight | 663.63 g/mol |
| Exact Mass | 663.11 |
| IUPAC Name | [3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc([N+](=O)[O-])c2c1COC(c1csc(C3CCN(C(=O)Cn4nc(C(F)F)cc4C(F)F)CC3)n1)OC2 |
| InChI | InChI=1S/C25H25F4N5O8S2/c1-44(38,39)42-20-3-2-18(34(36)37)14-10-40-25(41-11-15(14)20)17-12-43-24(30-17)13-4-6-32(7-5-13)21(35)9-33-19(23(28)29)8-16(31-33)22(26)27/h2-3,8,12-13,22-23,25H,4-7,9-11H2,1H3 |
| InChIKey | IBPRGZFMGJZHSU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 155.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|