C19H23N3O6S2 — CID 145339684
[3-[2-(1-carbamoylpiperidin-4-yl)-1,3-thiazol-4-yl]-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate (PubChem CID 145339684) has the molecular formula C19H23N3O6S2 and a molecular weight of 453.54 g/mol. Its IUPAC name is [3-[2-(1-carbamoylpiperidin-4-yl)-1,3-thiazol-4-yl]-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate.
| Compound Name | [3-[2-(1-carbamoylpiperidin-4-yl)-1,3-thiazol-4-yl]-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 145339684 |
| Molecular Formula | C19H23N3O6S2 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [3-[2-(1-carbamoylpiperidin-4-yl)-1,3-thiazol-4-yl]-1,5-dihydro-2,4-benzodioxepin-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc2c1COC(c1csc(C3CCN(C(N)=O)CC3)n1)OC2 |
| InChI | InChI=1S/C19H23N3O6S2/c1-30(24,25)28-16-4-2-3-13-9-26-18(27-10-14(13)16)15-11-29-17(21-15)12-5-7-22(8-6-12)19(20)23/h2-4,11-12,18H,5-10H2,1H3,(H2,20,23) |
| InChIKey | LQYAICRXUCGTAD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|