C26H29F5N6O4S2 — CID 150779544
[3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]propanoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-fluoro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate (PubChem CID 150779544) has the molecular formula C26H29F5N6O4S2 and a molecular weight of 648.68 g/mol. Its IUPAC name is [3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]propanoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-fluoro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate.
| Compound Name | [3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]propanoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-fluoro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate |
|---|---|
| PubChem CID | 150779544 |
| Molecular Formula | C26H29F5N6O4S2 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | [3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]propanoyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-fluoro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate |
| SMILES | CC(C(=O)N1CCC(c2nc(C3NCc4c(F)ccc(OS(C)(=O)=O)c4CN3)cs2)CC1)n1nc(C(F)F)cc1C(F)F |
| InChI | InChI=1S/C26H29F5N6O4S2/c1-13(37-20(23(30)31)9-18(35-37)22(28)29)26(38)36-7-5-14(6-8-36)25-34-19(12-42-25)24-32-10-15-16(11-33-24)21(4-3-17(15)27)41-43(2,39)40/h3-4,9,12-14,22-24,32-33H,5-8,10-11H2,1-2H3 |
| InChIKey | KBOSZTLEPLFXMD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|