C25H25F6IN6O3S2 — CID 151149105
[3-[2-[1-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-iodo-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate (PubChem CID 151149105) has the molecular formula C25H25F6IN6O3S2 and a molecular weight of 762.54 g/mol. Its IUPAC name is [3-[2-[1-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-iodo-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate.
| Compound Name | [3-[2-[1-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-iodo-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate |
|---|---|
| PubChem CID | 151149105 |
| Molecular Formula | C25H25F6IN6O3S2 |
| Molecular Weight | 762.54 g/mol |
| Exact Mass | 762.04 |
| IUPAC Name | [3-[2-[1-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-6-iodo-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-9-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(I)c2c1CNC(c1csc(C3CCN(C=Cn4nc(C(F)(F)F)cc4C(F)(F)F)CC3)n1)NC2 |
| InChI | InChI=1S/C25H25F6IN6O3S2/c1-43(39,40)41-19-3-2-17(32)15-11-33-22(34-12-16(15)19)18-13-42-23(35-18)14-4-6-37(7-5-14)8-9-38-21(25(29,30)31)10-20(36-38)24(26,27)28/h2-3,8-10,13-14,22,33-34H,4-7,11-12H2,1H3 |
| InChIKey | MXVJLDFLFHGKNF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|