C25H28F3N7O3S — CID 152618444
4-(6-methoxy-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl)-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole (PubChem CID 152618444) has the molecular formula C25H28F3N7O3S and a molecular weight of 563.61 g/mol. Its IUPAC name is 4-(6-methoxy-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl)-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole.
| Compound Name | 4-(6-methoxy-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl)-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 152618444 |
| Molecular Formula | C25H28F3N7O3S |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 4-(6-methoxy-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl)-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole |
| SMILES | COc1ccc([N+](=O)[O-])c2c1CNC(c1csc(C3CCN(C=Cn4nc(C(F)(F)F)cc4C)CC3)n1)NC2 |
| InChI | InChI=1S/C25H28F3N7O3S/c1-15-11-22(25(26,27)28)32-34(15)10-9-33-7-5-16(6-8-33)24-31-19(14-39-24)23-29-12-17-18(13-30-23)21(38-2)4-3-20(17)35(36)37/h3-4,9-11,14,16,23,29-30H,5-8,12-13H2,1-2H3 |
| InChIKey | ZBABBKHRIQJJQR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|