C25H28ClF3N6S — CID 152587955
4-[6-(chloromethyl)-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl]-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole (PubChem CID 152587955) has the molecular formula C25H28ClF3N6S and a molecular weight of 537.06 g/mol. Its IUPAC name is 4-[6-(chloromethyl)-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl]-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole.
| Compound Name | 4-[6-(chloromethyl)-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl]-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 152587955 |
| Molecular Formula | C25H28ClF3N6S |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 4-[6-(chloromethyl)-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-3-yl]-2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazole |
| SMILES | Cc1cc(C(F)(F)F)nn1C=CN1CCC(c2nc(C3NCc4cccc(CCl)c4CN3)cs2)CC1 |
| InChI | InChI=1S/C25H28ClF3N6S/c1-16-11-22(25(27,28)29)33-35(16)10-9-34-7-5-17(6-8-34)24-32-21(15-36-24)23-30-13-19-4-2-3-18(12-26)20(19)14-31-23/h2-4,9-11,15,17,23,30-31H,5-8,12-14H2,1H3 |
| InChIKey | YUVTZTWWAGVWBB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|