C25H28F3N7O5S2 — CID 151598154
[3-[2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-6-yl] methanesulfonate (PubChem CID 151598154) has the molecular formula C25H28F3N7O5S2 and a molecular weight of 627.67 g/mol. Its IUPAC name is [3-[2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-6-yl] methanesulfonate.
| Compound Name | [3-[2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 151598154 |
| Molecular Formula | C25H28F3N7O5S2 |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | [3-[2-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethenyl]piperidin-4-yl]-1,3-thiazol-4-yl]-9-nitro-2,3,4,5-tetrahydro-1H-2,4-benzodiazepin-6-yl] methanesulfonate |
| SMILES | Cc1cc(C(F)(F)F)nn1C=CN1CCC(c2nc(C3NCc4c(OS(C)(=O)=O)ccc([N+](=O)[O-])c4CN3)cs2)CC1 |
| InChI | InChI=1S/C25H28F3N7O5S2/c1-15-11-22(25(26,27)28)32-34(15)10-9-33-7-5-16(6-8-33)24-31-19(14-41-24)23-29-12-17-18(13-30-23)21(40-42(2,38)39)4-3-20(17)35(36)37/h3-4,9-11,14,16,23,29-30H,5-8,12-13H2,1-2H3 |
| InChIKey | QJXHQPUSRBAQQX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|