C8H14N2O4 — CID 129247600
[1-(2-hydroxy-2-methylpropanoyl)azetidin-3-yl]carbamic acid (PubChem CID 129247600) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is [1-(2-hydroxy-2-methylpropanoyl)azetidin-3-yl]carbamic acid.
| Compound Name | [1-(2-hydroxy-2-methylpropanoyl)azetidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 129247600 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | [1-(2-hydroxy-2-methylpropanoyl)azetidin-3-yl]carbamic acid |
| SMILES | CC(C)(O)C(=O)N1CC(NC(=O)O)C1 |
| InChI | InChI=1S/C8H14N2O4/c1-8(2,14)6(11)10-3-5(4-10)9-7(12)13/h5,9,14H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | OXLWRJCMTRVQLF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |