C28H28F3N3O4S — CID 129248708
N-[4-methyl-3-[5-(methylsulfonylmethyl)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 129248708) has the molecular formula C28H28F3N3O4S and a molecular weight of 559.61 g/mol. Its IUPAC name is N-[4-methyl-3-[5-(methylsulfonylmethyl)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[4-methyl-3-[5-(methylsulfonylmethyl)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129248708 |
| Molecular Formula | C28H28F3N3O4S |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | N-[4-methyl-3-[5-(methylsulfonylmethyl)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(F)(F)F)c2)cc1-c1ccc2c(c1)N1CCOCC1C(CS(C)(=O)=O)C2 |
| InChI | InChI=1S/C28H28F3N3O4S/c1-17-3-6-22(33-27(35)20-7-8-32-26(13-20)28(29,30)31)14-23(17)18-4-5-19-11-21(16-39(2,36)37)25-15-38-10-9-34(25)24(19)12-18/h3-8,12-14,21,25H,9-11,15-16H2,1-2H3,(H,33,35) |
| InChIKey | OXCPPANDYKSSIB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |