C28H27F3N4O3 — CID 129248836
N-[3-(6-ethyl-10b-methyl-5-oxo-1,2,4,4a-tetrahydropyrano[3,4-c][1,8]naphthyridin-9-yl)-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 129248836) has the molecular formula C28H27F3N4O3 and a molecular weight of 524.54 g/mol. Its IUPAC name is N-[3-(6-ethyl-10b-methyl-5-oxo-1,2,4,4a-tetrahydropyrano[3,4-c][1,8]naphthyridin-9-yl)-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-(6-ethyl-10b-methyl-5-oxo-1,2,4,4a-tetrahydropyrano[3,4-c][1,8]naphthyridin-9-yl)-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129248836 |
| Molecular Formula | C28H27F3N4O3 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-[3-(6-ethyl-10b-methyl-5-oxo-1,2,4,4a-tetrahydropyrano[3,4-c][1,8]naphthyridin-9-yl)-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCN1C(=O)C2COCCC2(C)c2cc(-c3cc(NC(=O)c4cncc(C(F)(F)F)c4)ccc3C)cnc21 |
| InChI | InChI=1S/C28H27F3N4O3/c1-4-35-24-22(27(3)7-8-38-15-23(27)26(35)37)10-17(13-33-24)21-11-20(6-5-16(21)2)34-25(36)18-9-19(14-32-12-18)28(29,30)31/h5-6,9-14,23H,4,7-8,15H2,1-3H3,(H,34,36) |
| InChIKey | RMQRDEKSCOUERG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |