C17H19NO5 — CID 129251331
[3-[(4Z)-9-bicyclo[6.1.0]non-4-enyl]-2-methyl-4-nitrophenyl] hydrogen carbonate (PubChem CID 129251331) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is [3-[(4Z)-9-bicyclo[6.1.0]non-4-enyl]-2-methyl-4-nitrophenyl] hydrogen carbonate.
| Compound Name | [3-[(4Z)-9-bicyclo[6.1.0]non-4-enyl]-2-methyl-4-nitrophenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 129251331 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [3-[(4Z)-9-bicyclo[6.1.0]non-4-enyl]-2-methyl-4-nitrophenyl] hydrogen carbonate |
| SMILES | Cc1c(OC(=O)O)ccc([N+](=O)[O-])c1C1C2CC/C=C\CCC21 |
| InChI | InChI=1S/C17H19NO5/c1-10-14(23-17(19)20)9-8-13(18(21)22)15(10)16-11-6-4-2-3-5-7-12(11)16/h2-3,8-9,11-12,16H,4-7H2,1H3,(H,19,20)/b3-2- |
| InChIKey | ABNPCYVAKUBIHI-IHWYPQMZSA-N |
| XLogP | 4.42 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|