C11H17NO — CID 129252446
(2E)-N-tert-butyl-2-ethenylpenta-2,4-dienamide (PubChem CID 129252446) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2E)-N-tert-butyl-2-ethenylpenta-2,4-dienamide.
| Compound Name | (2E)-N-tert-butyl-2-ethenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 129252446 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2E)-N-tert-butyl-2-ethenylpenta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H17NO/c1-6-8-9(7-2)10(13)12-11(3,4)5/h6-8H,1-2H2,3-5H3,(H,12,13)/b9-8+ |
| InChIKey | KUEZANCJEIUWLR-CMDGGOBGSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|