C13H23NO — CID 135042526
(2E,4E)-N-tert-butyl-6,6-dimethylhepta-2,4-dienamide (PubChem CID 135042526) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2E,4E)-N-tert-butyl-6,6-dimethylhepta-2,4-dienamide.
| Compound Name | (2E,4E)-N-tert-butyl-6,6-dimethylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 135042526 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2E,4E)-N-tert-butyl-6,6-dimethylhepta-2,4-dienamide |
| SMILES | CC(C)(C)/C=C/C=C/C(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H23NO/c1-12(2,3)10-8-7-9-11(15)14-13(4,5)6/h7-10H,1-6H3,(H,14,15)/b9-7+,10-8+ |
| InChIKey | GOAIKXZJZUWHIY-FIFLTTCUSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|