C10H17NO — CID 131234353
(2E)-N-tert-butyl-4-methylpenta-2,4-dienamide (PubChem CID 131234353) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2E)-N-tert-butyl-4-methylpenta-2,4-dienamide.
| Compound Name | (2E)-N-tert-butyl-4-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 131234353 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2E)-N-tert-butyl-4-methylpenta-2,4-dienamide |
| SMILES | C=C(C)/C=C/C(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H17NO/c1-8(2)6-7-9(12)11-10(3,4)5/h6-7H,1H2,2-5H3,(H,11,12)/b7-6+ |
| InChIKey | YXSJBEZSIWDVEG-VOTSOKGWSA-N |
| XLogP | 2.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|