C19H37N — CID 129252687
3-butan-2-yl-N-(4-ethyl-2-methylhex-5-en-2-yl)-N,2,2-trimethylcyclopropan-1-amine (PubChem CID 129252687) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is 3-butan-2-yl-N-(4-ethyl-2-methylhex-5-en-2-yl)-N,2,2-trimethylcyclopropan-1-amine.
| Compound Name | 3-butan-2-yl-N-(4-ethyl-2-methylhex-5-en-2-yl)-N,2,2-trimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 129252687 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | 3-butan-2-yl-N-(4-ethyl-2-methylhex-5-en-2-yl)-N,2,2-trimethylcyclopropan-1-amine |
| SMILES | C=CC(CC)CC(C)(C)N(C)C1C(C(C)CC)C1(C)C |
| InChI | InChI=1S/C19H37N/c1-10-14(4)16-17(19(16,7)8)20(9)18(5,6)13-15(11-2)12-3/h11,14-17H,2,10,12-13H2,1,3-9H3 |
| InChIKey | QGPWHXHSDDGWEL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|