C35H32N4O4S — CID 129252803
(1R,19R)-6-(1,3-benzothiazol-2-ylmethoxy)-15-(6-methoxy-3-pyridinyl)-12,15-dimethyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4(9),5,7,13,16(20)-hexaene-19-carboxylic acid (PubChem CID 129252803) has the molecular formula C35H32N4O4S and a molecular weight of 604.73 g/mol. Its IUPAC name is (1R,19R)-6-(1,3-benzothiazol-2-ylmethoxy)-15-(6-methoxy-3-pyridinyl)-12,15-dimethyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4(9),5,7,13,16(20)-hexaene-19-carboxylic acid.
| Compound Name | (1R,19R)-6-(1,3-benzothiazol-2-ylmethoxy)-15-(6-methoxy-3-pyridinyl)-12,15-dimethyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4(9),5,7,13,16(20)-hexaene-19-carboxylic acid |
|---|---|
| PubChem CID | 129252803 |
| Molecular Formula | C35H32N4O4S |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | (1R,19R)-6-(1,3-benzothiazol-2-ylmethoxy)-15-(6-methoxy-3-pyridinyl)-12,15-dimethyl-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4(9),5,7,13,16(20)-hexaene-19-carboxylic acid |
| SMILES | COc1ccc(C2(C)C=CC3(C)Cn4c(nc5cc(OCc6nc7ccccc7s6)ccc54)[C@H]4C3=C2CC[C@H]4C(=O)O)cn1 |
| InChI | InChI=1S/C35H32N4O4S/c1-34-14-15-35(2,20-8-13-28(42-3)36-17-20)23-11-10-22(33(40)41)30(31(23)34)32-38-25-16-21(9-12-26(25)39(32)19-34)43-18-29-37-24-6-4-5-7-27(24)44-29/h4-9,12-17,22,30H,10-11,18-19H2,1-3H3,(H,40,41)/t22-,30-,34?,35?/m1/s1 |
| InChIKey | HEBQACHNCDEAQF-NEDDICBISA-N |
| XLogP | 7.05 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|